About ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid
ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid (PubChem CID 174766261) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid |
| PubChem CID | 174766261 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid |
| SMILES | C=C.C=C1CCCC(C)(C)C1(C)C(=O)O |
| InChI | InChI=1S/C11H18O2.C2H4/c1-8-6-5-7-10(2,3)11(8,4)9(12)13;1-2/h1,5-7H2,2-4H3,(H,12,13);1-2H2 |
| InChIKey | KVSAHMGEWQIPMG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid?
The IUPAC name of ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid (CID 174766261) is ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid.
What is the SMILES notation for ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid?
The canonical SMILES for ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid is C=C.C=C1CCCC(C)(C)C1(C)C(=O)O.
What is the InChIKey of ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid?
The InChIKey is KVSAHMGEWQIPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2.C2H4/c1-8-6-5-7-10(2,3)11(8,4)9(12)13;1-2/h1,5-7H2,2-4H3,(H,12,13);1-2H2.
What are the key properties of ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid?
ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid has a molecular weight of 210.32 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1,2,2-trimethyl-6-methylidenecyclohexane-1-carboxylic acid is sourced from PubChem (CID 174766261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).