C9H7F2NO2S — CID 174783947
7-(difluoromethoxy)-2,3-dihydro-1,3-benzoxazole-2-carbothialdehyde (PubChem CID 174783947) has the molecular formula C9H7F2NO2S and a molecular weight of 231.22 g/mol. Its IUPAC name is 7-(difluoromethoxy)-2,3-dihydro-1,3-benzoxazole-2-carbothialdehyde.
| Compound Name | 7-(difluoromethoxy)-2,3-dihydro-1,3-benzoxazole-2-carbothialdehyde |
|---|---|
| PubChem CID | 174783947 |
| Molecular Formula | C9H7F2NO2S |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 7-(difluoromethoxy)-2,3-dihydro-1,3-benzoxazole-2-carbothialdehyde |
| SMILES | FC(F)Oc1cccc2c1OC(C=S)N2 |
| InChI | InChI=1S/C9H7F2NO2S/c10-9(11)13-6-3-1-2-5-8(6)14-7(4-15)12-5/h1-4,7,9,12H |
| InChIKey | QWMWLPZUYNSCFS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|