C24H22F3N3O3 — CID 174784888
methyl 4-[[[2-cyclopropyl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-formylamino]methyl]benzoate (PubChem CID 174784888) has the molecular formula C24H22F3N3O3 and a molecular weight of 457.45 g/mol. Its IUPAC name is methyl 4-[[[2-cyclopropyl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-formylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-cyclopropyl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-formylamino]methyl]benzoate |
|---|---|
| PubChem CID | 174784888 |
| Molecular Formula | C24H22F3N3O3 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | methyl 4-[[[2-cyclopropyl-3-[[4-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]-formylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C=O)c2cnc(C3CC3)n2Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H22F3N3O3/c1-33-23(32)19-6-2-16(3-7-19)13-29(15-31)21-12-28-22(18-8-9-18)30(21)14-17-4-10-20(11-5-17)24(25,26)27/h2-7,10-12,15,18H,8-9,13-14H2,1H3 |
| InChIKey | QMSYFBRPTYIVAL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|