About [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate
[2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate (PubChem CID 174791891) has the molecular formula C18H14N2O4
and a molecular weight of 322.32 g/mol. Its IUPAC name is [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate.
Molecular Properties
| Compound Name | [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate |
| PubChem CID | 174791891 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate |
| SMILES | O=COC(OCc1ccccc1)C(=O)c1cnc2ncccc2c1 |
| InChI | InChI=1S/C18H14N2O4/c21-12-24-18(23-11-13-5-2-1-3-6-13)16(22)15-9-14-7-4-8-19-17(14)20-10-15/h1-10,12,18H,11H2 |
| InChIKey | QWDGFATXKJSGSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate?
The IUPAC name of [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate (CID 174791891) is [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate.
What is the SMILES notation for [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate?
The canonical SMILES for [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate is O=COC(OCc1ccccc1)C(=O)c1cnc2ncccc2c1.
What is the InChIKey of [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate?
The InChIKey is QWDGFATXKJSGSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O4/c21-12-24-18(23-11-13-5-2-1-3-6-13)16(22)15-9-14-7-4-8-19-17(14)20-10-15/h1-10,12,18H,11H2.
What are the key properties of [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate?
[2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate has a molecular weight of 322.32 g/mol, XLogP of 2.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,8-naphthyridin-3-yl)-2-oxo-1-phenylmethoxyethyl] formate is sourced from PubChem (CID 174791891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).