C9H14O4 — CID 174793322
3,7-dioxoheptyl acetate (PubChem CID 174793322) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3,7-dioxoheptyl acetate.
| Compound Name | 3,7-dioxoheptyl acetate |
|---|---|
| PubChem CID | 174793322 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3,7-dioxoheptyl acetate |
| SMILES | CC(=O)OCCC(=O)CCCC=O |
| InChI | InChI=1S/C9H14O4/c1-8(11)13-7-5-9(12)4-2-3-6-10/h6H,2-5,7H2,1H3 |
| InChIKey | KYVLEQDNTSVLJS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|