C17H26N4 — CID 174793752
butane-1,2,2-triamine;1,2,3,4-tetrahydroacridine (PubChem CID 174793752) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is butane-1,2,2-triamine;1,2,3,4-tetrahydroacridine.
| Compound Name | butane-1,2,2-triamine;1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 174793752 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | butane-1,2,2-triamine;1,2,3,4-tetrahydroacridine |
| SMILES | CCC(N)(N)CN.c1ccc2nc3c(cc2c1)CCCC3 |
| InChI | InChI=1S/C13H13N.C4H13N3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-4(6,7)3-5/h1,3,5,7,9H,2,4,6,8H2;2-3,5-7H2,1H3 |
| InChIKey | PAGONULAXVFXBY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|