About 5-bromo-2-methylpyridine;formic acid
5-bromo-2-methylpyridine;formic acid (PubChem CID 174794271) has the molecular formula C7H8BrNO2
and a molecular weight of 218.05 g/mol. Its IUPAC name is 5-bromo-2-methylpyridine;formic acid.
Molecular Properties
| Compound Name | 5-bromo-2-methylpyridine;formic acid |
| PubChem CID | 174794271 |
| Molecular Formula | C7H8BrNO2 |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 5-bromo-2-methylpyridine;formic acid |
| SMILES | Cc1ccc(Br)cn1.O=CO |
| InChI | InChI=1S/C6H6BrN.CH2O2/c1-5-2-3-6(7)4-8-5;2-1-3/h2-4H,1H3;1H,(H,2,3) |
| InChIKey | VFMRQTMAAYEELK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methylpyridine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methylpyridine;formic acid?
The IUPAC name of 5-bromo-2-methylpyridine;formic acid (CID 174794271) is 5-bromo-2-methylpyridine;formic acid.
What is the SMILES notation for 5-bromo-2-methylpyridine;formic acid?
The canonical SMILES for 5-bromo-2-methylpyridine;formic acid is Cc1ccc(Br)cn1.O=CO.
What is the InChIKey of 5-bromo-2-methylpyridine;formic acid?
The InChIKey is VFMRQTMAAYEELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.CH2O2/c1-5-2-3-6(7)4-8-5;2-1-3/h2-4H,1H3;1H,(H,2,3).
What are the key properties of 5-bromo-2-methylpyridine;formic acid?
5-bromo-2-methylpyridine;formic acid has a molecular weight of 218.05 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methylpyridine;formic acid is sourced from PubChem (CID 174794271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).