C19H23BrN4O2S — CID 177332850
4-(4-bromo-2-methylphenyl)-N-(6-methyl-3-pyridinyl)piperazine-1-carbothioamide;formic acid (PubChem CID 177332850) has the molecular formula C19H23BrN4O2S and a molecular weight of 451.39 g/mol. Its IUPAC name is 4-(4-bromo-2-methylphenyl)-N-(6-methyl-3-pyridinyl)piperazine-1-carbothioamide;formic acid.
| Compound Name | 4-(4-bromo-2-methylphenyl)-N-(6-methyl-3-pyridinyl)piperazine-1-carbothioamide;formic acid |
|---|---|
| PubChem CID | 177332850 |
| Molecular Formula | C19H23BrN4O2S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 4-(4-bromo-2-methylphenyl)-N-(6-methyl-3-pyridinyl)piperazine-1-carbothioamide;formic acid |
| SMILES | Cc1ccc(NC(=S)N2CCN(c3ccc(Br)cc3C)CC2)cn1.O=CO |
| InChI | InChI=1S/C18H21BrN4S.CH2O2/c1-13-11-15(19)4-6-17(13)22-7-9-23(10-8-22)18(24)21-16-5-3-14(2)20-12-16;2-1-3/h3-6,11-12H,7-10H2,1-2H3,(H,21,24);1H,(H,2,3) |
| InChIKey | JZHLRBUAYCUCEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|