C21H29ClO2 — CID 174795977
1-chloro-4-(3-methoxy-3-methylcyclohexyl)benzene;cyclohexene-1-carbaldehyde (PubChem CID 174795977) has the molecular formula C21H29ClO2 and a molecular weight of 348.91 g/mol. Its IUPAC name is 1-chloro-4-(3-methoxy-3-methylcyclohexyl)benzene;cyclohexene-1-carbaldehyde.
| Compound Name | 1-chloro-4-(3-methoxy-3-methylcyclohexyl)benzene;cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 174795977 |
| Molecular Formula | C21H29ClO2 |
| Molecular Weight | 348.91 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-chloro-4-(3-methoxy-3-methylcyclohexyl)benzene;cyclohexene-1-carbaldehyde |
| SMILES | COC1(C)CCCC(c2ccc(Cl)cc2)C1.O=CC1=CCCCC1 |
| InChI | InChI=1S/C14H19ClO.C7H10O/c1-14(16-2)9-3-4-12(10-14)11-5-7-13(15)8-6-11;8-6-7-4-2-1-3-5-7/h5-8,12H,3-4,9-10H2,1-2H3;4,6H,1-3,5H2 |
| InChIKey | QQWKWDRQFHWQLF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|