C26H24N4O3S2 — CID 174796595
acridine;2-amino-5-(2-aminoethyl)naphthalene-1-sulfonic acid;isothiocyanic acid (PubChem CID 174796595) has the molecular formula C26H24N4O3S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is acridine;2-amino-5-(2-aminoethyl)naphthalene-1-sulfonic acid;isothiocyanic acid.
| Compound Name | acridine;2-amino-5-(2-aminoethyl)naphthalene-1-sulfonic acid;isothiocyanic acid |
|---|---|
| PubChem CID | 174796595 |
| Molecular Formula | C26H24N4O3S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | acridine;2-amino-5-(2-aminoethyl)naphthalene-1-sulfonic acid;isothiocyanic acid |
| SMILES | N=C=S.NCCc1cccc2c(S(=O)(=O)O)c(N)ccc12.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C12H14N2O3S.CHNS/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;13-7-6-8-2-1-3-10-9(8)4-5-11(14)12(10)18(15,16)17;2-1-3/h1-9H;1-5H,6-7,13-14H2,(H,15,16,17);2H |
| InChIKey | NUWIMCHOLQBIGS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|