About λ2-plumbane;N-phenylnitramide
λ2-plumbane;N-phenylnitramide (PubChem CID 174797622) has the molecular formula C6H8N2O2Pb
and a molecular weight of 347.34 g/mol. Its IUPAC name is λ2-plumbane;N-phenylnitramide.
Molecular Properties
| Compound Name | λ2-plumbane;N-phenylnitramide |
| PubChem CID | 174797622 |
| Molecular Formula | C6H8N2O2Pb |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | λ2-plumbane;N-phenylnitramide |
| SMILES | O=[N+]([O-])Nc1ccccc1.[PbH2] |
| InChI | InChI=1S/C6H6N2O2.Pb.2H/c9-8(10)7-6-4-2-1-3-5-6;;;/h1-5,7H;;; |
| InChIKey | RSUYUVXURMVMTB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze λ2-plumbane;N-phenylnitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-plumbane;N-phenylnitramide?
The IUPAC name of λ2-plumbane;N-phenylnitramide (CID 174797622) is λ2-plumbane;N-phenylnitramide.
What is the SMILES notation for λ2-plumbane;N-phenylnitramide?
The canonical SMILES for λ2-plumbane;N-phenylnitramide is O=[N+]([O-])Nc1ccccc1.[PbH2].
What is the InChIKey of λ2-plumbane;N-phenylnitramide?
The InChIKey is RSUYUVXURMVMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2.Pb.2H/c9-8(10)7-6-4-2-1-3-5-6;;;/h1-5,7H;;;.
What are the key properties of λ2-plumbane;N-phenylnitramide?
λ2-plumbane;N-phenylnitramide has a molecular weight of 347.34 g/mol, XLogP of 0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;N-phenylnitramide is sourced from PubChem (CID 174797622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).