anilinomethyl nitrate

C7H8N2O3 — CID 87550626

IUPACanilinomethyl nitrate
SMILESO=[N+]([O-])OCNc1ccccc1
InChIInChI=1S/C7H8N2O3/c10-9(11)12-6-8-7-4-2-1-3-5-7/h1-5,8H,6H2
InChIKeyBPOZPUDTENHESW-UHFFFAOYSA-N
MW168.15 g/mol
LogP1.26
Rot. Bonds4

About anilinomethyl nitrate

anilinomethyl nitrate (PubChem CID 87550626) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is anilinomethyl nitrate.

Molecular Properties

Compound Nameanilinomethyl nitrate
PubChem CID87550626
Molecular FormulaC7H8N2O3
Molecular Weight168.15 g/mol
Exact Mass168.05
IUPAC Nameanilinomethyl nitrate
SMILESO=[N+]([O-])OCNc1ccccc1
InChIInChI=1S/C7H8N2O3/c10-9(11)12-6-8-7-4-2-1-3-5-7/h1-5,8H,6H2
InChIKeyBPOZPUDTENHESW-UHFFFAOYSA-N
XLogP1.26
TPSA64.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 51.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze anilinomethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of anilinomethyl nitrate?
The IUPAC name of anilinomethyl nitrate (CID 87550626) is anilinomethyl nitrate.
What is the SMILES notation for anilinomethyl nitrate?
The canonical SMILES for anilinomethyl nitrate is O=[N+]([O-])OCNc1ccccc1.
What is the InChIKey of anilinomethyl nitrate?
The InChIKey is BPOZPUDTENHESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-9(11)12-6-8-7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of anilinomethyl nitrate?
anilinomethyl nitrate has a molecular weight of 168.15 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anilinomethyl nitrate is sourced from PubChem (CID 87550626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).