About anilinomethyl nitrate
anilinomethyl nitrate (PubChem CID 87550626) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is anilinomethyl nitrate.
Molecular Properties
| Compound Name | anilinomethyl nitrate |
| PubChem CID | 87550626 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | anilinomethyl nitrate |
| SMILES | O=[N+]([O-])OCNc1ccccc1 |
| InChI | InChI=1S/C7H8N2O3/c10-9(11)12-6-8-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | BPOZPUDTENHESW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilinomethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilinomethyl nitrate?
The IUPAC name of anilinomethyl nitrate (CID 87550626) is anilinomethyl nitrate.
What is the SMILES notation for anilinomethyl nitrate?
The canonical SMILES for anilinomethyl nitrate is O=[N+]([O-])OCNc1ccccc1.
What is the InChIKey of anilinomethyl nitrate?
The InChIKey is BPOZPUDTENHESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-9(11)12-6-8-7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of anilinomethyl nitrate?
anilinomethyl nitrate has a molecular weight of 168.15 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anilinomethyl nitrate is sourced from PubChem (CID 87550626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).