C7H9NO2S — CID 174806498
(4,5-dimethyl-1,3-thiazol-2-yl)methyl formate (PubChem CID 174806498) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-thiazol-2-yl)methyl formate.
| Compound Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl formate |
|---|---|
| PubChem CID | 174806498 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl formate |
| SMILES | Cc1nc(COC=O)sc1C |
| InChI | InChI=1S/C7H9NO2S/c1-5-6(2)11-7(8-5)3-10-4-9/h4H,3H2,1-2H3 |
| InChIKey | IEHXMWDLQFPODX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|