C28H21N5O4 — CID 174808659
[2-[5-amino-1-[4-(3-cyanophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-1H-indol-5-yl]methyl formate (PubChem CID 174808659) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is [2-[5-amino-1-[4-(3-cyanophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-1H-indol-5-yl]methyl formate.
| Compound Name | [2-[5-amino-1-[4-(3-cyanophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-1H-indol-5-yl]methyl formate |
|---|---|
| PubChem CID | 174808659 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [2-[5-amino-1-[4-(3-cyanophenoxy)-2-methylphenyl]pyrazole-4-carbonyl]-1H-indol-5-yl]methyl formate |
| SMILES | Cc1cc(Oc2cccc(C#N)c2)ccc1-n1ncc(C(=O)c2cc3cc(COC=O)ccc3[nH]2)c1N |
| InChI | InChI=1S/C28H21N5O4/c1-17-9-22(37-21-4-2-3-18(11-21)13-29)6-8-26(17)33-28(30)23(14-31-33)27(35)25-12-20-10-19(15-36-16-34)5-7-24(20)32-25/h2-12,14,16,32H,15,30H2,1H3 |
| InChIKey | DUZXWEJOSMNZOX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|