C16H32N2O4 — CID 174810218
2-(dimethylamino)ethyl 2-methylprop-2-enoate;octyl nitrite (PubChem CID 174810218) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;octyl nitrite.
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;octyl nitrite |
|---|---|
| PubChem CID | 174810218 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;octyl nitrite |
| SMILES | C=C(C)C(=O)OCCN(C)C.CCCCCCCCON=O |
| InChI | InChI=1S/C8H15NO2.C8H17NO2/c1-7(2)8(10)11-6-5-9(3)4;1-2-3-4-5-6-7-8-11-9-10/h1,5-6H2,2-4H3;2-8H2,1H3 |
| InChIKey | WBHFANQHUYHDOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|