C10H14O6Zn — CID 174812080
4-(2-hydroxy-3-oxopent-4-enoxy)-3-methyl-4-oxobutanoic acid;zinc (PubChem CID 174812080) has the molecular formula C10H14O6Zn and a molecular weight of 295.61 g/mol. Its IUPAC name is 4-(2-hydroxy-3-oxopent-4-enoxy)-3-methyl-4-oxobutanoic acid;zinc.
| Compound Name | 4-(2-hydroxy-3-oxopent-4-enoxy)-3-methyl-4-oxobutanoic acid;zinc |
|---|---|
| PubChem CID | 174812080 |
| Molecular Formula | C10H14O6Zn |
| Molecular Weight | 295.61 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-(2-hydroxy-3-oxopent-4-enoxy)-3-methyl-4-oxobutanoic acid;zinc |
| SMILES | C=CC(=O)C(O)COC(=O)C(C)CC(=O)O.[Zn] |
| InChI | InChI=1S/C10H14O6.Zn/c1-3-7(11)8(12)5-16-10(15)6(2)4-9(13)14;/h3,6,8,12H,1,4-5H2,2H3,(H,13,14); |
| InChIKey | JMXQODHVUQGDSA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.61 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|