C17H14BrFO4 — CID 174814663
4-[[2-(bromomethyl)-4-fluoro-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 174814663) has the molecular formula C17H14BrFO4 and a molecular weight of 381.20 g/mol. Its IUPAC name is 4-[[2-(bromomethyl)-4-fluoro-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[2-(bromomethyl)-4-fluoro-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174814663 |
| Molecular Formula | C17H14BrFO4 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 4-[[2-(bromomethyl)-4-fluoro-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(F)ccc(Cc2ccc(C(=O)O)cc2C(=O)O)c1CBr |
| InChI | InChI=1S/C17H14BrFO4/c1-9-14(8-18)11(4-5-15(9)19)6-10-2-3-12(16(20)21)7-13(10)17(22)23/h2-5,7H,6,8H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | DWIBFNOZHJSZDW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|