C19H19BrO4 — CID 174745742
4-[[2-(2-bromoethyl)-3,5-dimethylphenyl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 174745742) has the molecular formula C19H19BrO4 and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-[[2-(2-bromoethyl)-3,5-dimethylphenyl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[2-(2-bromoethyl)-3,5-dimethylphenyl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174745742 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-[[2-(2-bromoethyl)-3,5-dimethylphenyl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(C)c(CCBr)c(Cc2ccc(C(=O)O)cc2C(=O)O)c1 |
| InChI | InChI=1S/C19H19BrO4/c1-11-7-12(2)16(5-6-20)15(8-11)9-13-3-4-14(18(21)22)10-17(13)19(23)24/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IJGRAFAJLINHIH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|