About (3S)-3-aminoazepan-2-ol
(3S)-3-aminoazepan-2-ol (PubChem CID 174814816) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is (3S)-3-aminoazepan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-aminoazepan-2-ol |
| PubChem CID | 174814816 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (3S)-3-aminoazepan-2-ol |
| SMILES | N[C@H]1CCCCNC1O |
| InChI | InChI=1S/C6H14N2O/c7-5-3-1-2-4-8-6(5)9/h5-6,8-9H,1-4,7H2/t5-,6?/m0/s1 |
| InChIKey | GLGNCEHLKPJBJT-ZBHICJROSA-N |
| XLogP | -0.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-aminoazepan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-aminoazepan-2-ol?
The IUPAC name of (3S)-3-aminoazepan-2-ol (CID 174814816) is (3S)-3-aminoazepan-2-ol.
What is the SMILES notation for (3S)-3-aminoazepan-2-ol?
The canonical SMILES for (3S)-3-aminoazepan-2-ol is N[C@H]1CCCCNC1O.
What is the InChIKey of (3S)-3-aminoazepan-2-ol?
The InChIKey is GLGNCEHLKPJBJT-ZBHICJROSA-N. The full InChI is InChI=1S/C6H14N2O/c7-5-3-1-2-4-8-6(5)9/h5-6,8-9H,1-4,7H2/t5-,6?/m0/s1.
What are the key properties of (3S)-3-aminoazepan-2-ol?
(3S)-3-aminoazepan-2-ol has a molecular weight of 130.19 g/mol, XLogP of -0.59, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-aminoazepan-2-ol is sourced from PubChem (CID 174814816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).