About oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium
oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium (PubChem CID 174814891) has the molecular formula C9H8O2S2+2
and a molecular weight of 212.29 g/mol. Its IUPAC name is oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium.
Molecular Properties
| Compound Name | oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium |
| PubChem CID | 174814891 |
| Molecular Formula | C9H8O2S2+2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium |
| SMILES | C#CC[S+]=O.O=[S+]c1ccccc1 |
| InChI | InChI=1S/C6H5OS.C3H3OS/c7-8-6-4-2-1-3-5-6;1-2-3-5-4/h1-5H;1H,3H2/q2*+1 |
| InChIKey | CSZYCGIXZRRACS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium?
The IUPAC name of oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium (CID 174814891) is oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium.
What is the SMILES notation for oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium?
The canonical SMILES for oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium is C#CC[S+]=O.O=[S+]c1ccccc1.
What is the InChIKey of oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium?
The InChIKey is CSZYCGIXZRRACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5OS.C3H3OS/c7-8-6-4-2-1-3-5-6;1-2-3-5-4/h1-5H;1H,3H2/q2*+1.
What are the key properties of oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium?
oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium has a molecular weight of 212.29 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxo(phenyl)sulfanium;oxo(prop-2-ynyl)sulfanium is sourced from PubChem (CID 174814891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).