(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid

C10H18O9 — CID 174815037

IUPAC(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid
SMILESCCO[C@](CC)(C(=O)O)C(O)C(=O)O.O=C(O)CO
InChIInChI=1S/C8H14O6.C2H4O3/c1-3-8(7(12)13,14-4-2)5(9)6(10)11;3-1-2(4)5/h5,9H,3-4H2,1-2H3,(H,10,11)(H,12,13);3H,1H2,(H,4,5)/t5?,8-;/m0./s1
InChIKeyUMBLIKPDZNKLOC-BVEJNZGXSA-N
MW282.25 g/mol
LogP-1.23
Rot. Bonds7

About (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid

(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid (PubChem CID 174815037) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid.

Molecular Properties

Compound Name(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid
PubChem CID174815037
Molecular FormulaC10H18O9
Molecular Weight282.25 g/mol
Exact Mass282.10
IUPAC Name(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid
SMILESCCO[C@](CC)(C(=O)O)C(O)C(=O)O.O=C(O)CO
InChIInChI=1S/C8H14O6.C2H4O3/c1-3-8(7(12)13,14-4-2)5(9)6(10)11;3-1-2(4)5/h5,9H,3-4H2,1-2H3,(H,10,11)(H,12,13);3H,1H2,(H,4,5)/t5?,8-;/m0./s1
InChIKeyUMBLIKPDZNKLOC-BVEJNZGXSA-N
XLogP-1.23
TPSA161.59 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.25
LogP ≤ 5-1.23
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid?
The IUPAC name of (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid (CID 174815037) is (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid.
What is the SMILES notation for (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid?
The canonical SMILES for (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid is CCO[C@](CC)(C(=O)O)C(O)C(=O)O.O=C(O)CO.
What is the InChIKey of (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid?
The InChIKey is UMBLIKPDZNKLOC-BVEJNZGXSA-N. The full InChI is InChI=1S/C8H14O6.C2H4O3/c1-3-8(7(12)13,14-4-2)5(9)6(10)11;3-1-2(4)5/h5,9H,3-4H2,1-2H3,(H,10,11)(H,12,13);3H,1H2,(H,4,5)/t5?,8-;/m0./s1.
What are the key properties of (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid?
(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid has a molecular weight of 282.25 g/mol, XLogP of -1.23, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid is sourced from PubChem (CID 174815037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).