C10H18O9 — CID 174815037
(2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid (PubChem CID 174815037) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid.
| Compound Name | (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid |
|---|---|
| PubChem CID | 174815037 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2S)-2-ethoxy-2-ethyl-3-hydroxybutanedioic acid;2-hydroxyacetic acid |
| SMILES | CCO[C@](CC)(C(=O)O)C(O)C(=O)O.O=C(O)CO |
| InChI | InChI=1S/C8H14O6.C2H4O3/c1-3-8(7(12)13,14-4-2)5(9)6(10)11;3-1-2(4)5/h5,9H,3-4H2,1-2H3,(H,10,11)(H,12,13);3H,1H2,(H,4,5)/t5?,8-;/m0./s1 |
| InChIKey | UMBLIKPDZNKLOC-BVEJNZGXSA-N |
| XLogP | -1.23 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |