C38H72N2O2 — CID 174815388
(Z)-2-amino-2-ethyl-4-oxo-3-[(Z)-pentadec-6-enyl]henicos-12-enamide (PubChem CID 174815388) has the molecular formula C38H72N2O2 and a molecular weight of 589.01 g/mol. Its IUPAC name is (Z)-2-amino-2-ethyl-4-oxo-3-[(Z)-pentadec-6-enyl]henicos-12-enamide.
| Compound Name | (Z)-2-amino-2-ethyl-4-oxo-3-[(Z)-pentadec-6-enyl]henicos-12-enamide |
|---|---|
| PubChem CID | 174815388 |
| Molecular Formula | C38H72N2O2 |
| Molecular Weight | 589.01 g/mol |
| Exact Mass | 588.56 |
| IUPAC Name | (Z)-2-amino-2-ethyl-4-oxo-3-[(Z)-pentadec-6-enyl]henicos-12-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CCCCC/C=C\CCCCCCCC)C(N)(CC)C(N)=O |
| InChI | InChI=1S/C38H72N2O2/c1-4-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36(41)35(38(40,6-3)37(39)42)33-31-29-27-25-23-21-18-16-14-12-10-8-5-2/h19-21,23,35H,4-18,22,24-34,40H2,1-3H3,(H2,39,42)/b20-19-,23-21- |
| InChIKey | SMQGRAOTRAFXNK-ASPAJGPZSA-N |
| XLogP | 11.06 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.01 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|