C12H18Br2S — CID 174815393
2-(2,8-dibromooctyl)thiophene (PubChem CID 174815393) has the molecular formula C12H18Br2S and a molecular weight of 354.15 g/mol. Its IUPAC name is 2-(2,8-dibromooctyl)thiophene.
| Compound Name | 2-(2,8-dibromooctyl)thiophene |
|---|---|
| PubChem CID | 174815393 |
| Molecular Formula | C12H18Br2S |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 2-(2,8-dibromooctyl)thiophene |
| SMILES | BrCCCCCCC(Br)Cc1cccs1 |
| InChI | InChI=1S/C12H18Br2S/c13-8-4-2-1-3-6-11(14)10-12-7-5-9-15-12/h5,7,9,11H,1-4,6,8,10H2 |
| InChIKey | KSRJCBLYGUSAIM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|