About N-bromo-N-iodomethanamine;λ2-plumbane
N-bromo-N-iodomethanamine;λ2-plumbane (PubChem CID 174816232) has the molecular formula CH5BrINPb
and a molecular weight of 445.07 g/mol. Its IUPAC name is N-bromo-N-iodomethanamine;λ2-plumbane.
Molecular Properties
| Compound Name | N-bromo-N-iodomethanamine;λ2-plumbane |
| PubChem CID | 174816232 |
| Molecular Formula | CH5BrINPb |
| Molecular Weight | 445.07 g/mol |
| Exact Mass | 444.84 |
| IUPAC Name | N-bromo-N-iodomethanamine;λ2-plumbane |
| SMILES | CN(Br)I.[PbH2] |
| InChI | InChI=1S/CH3BrIN.Pb.2H/c1-4(2)3;;;/h1H3;;; |
| InChIKey | SNHOGXMSQPXYEN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.07 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromo-N-iodomethanamine;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromo-N-iodomethanamine;λ2-plumbane?
The IUPAC name of N-bromo-N-iodomethanamine;λ2-plumbane (CID 174816232) is N-bromo-N-iodomethanamine;λ2-plumbane.
What is the SMILES notation for N-bromo-N-iodomethanamine;λ2-plumbane?
The canonical SMILES for N-bromo-N-iodomethanamine;λ2-plumbane is CN(Br)I.[PbH2].
What is the InChIKey of N-bromo-N-iodomethanamine;λ2-plumbane?
The InChIKey is SNHOGXMSQPXYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3BrIN.Pb.2H/c1-4(2)3;;;/h1H3;;;.
What are the key properties of N-bromo-N-iodomethanamine;λ2-plumbane?
N-bromo-N-iodomethanamine;λ2-plumbane has a molecular weight of 445.07 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromo-N-iodomethanamine;λ2-plumbane is sourced from PubChem (CID 174816232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).