About carbamimidoyl N-aminocarbamate
carbamimidoyl N-aminocarbamate (PubChem CID 174816859) has the molecular formula C2H6N4O2
and a molecular weight of 118.10 g/mol. Its IUPAC name is carbamimidoyl N-aminocarbamate.
Molecular Properties
| Compound Name | carbamimidoyl N-aminocarbamate |
| PubChem CID | 174816859 |
| Molecular Formula | C2H6N4O2 |
| Molecular Weight | 118.10 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | carbamimidoyl N-aminocarbamate |
| SMILES | [H]/N=C(\N)OC(=O)NN |
| InChI | InChI=1S/C2H6N4O2/c3-1(4)8-2(7)6-5/h5H2,(H3,3,4)(H,6,7) |
| InChIKey | GUOBVGQXEXTHEF-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.10 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbamimidoyl N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamimidoyl N-aminocarbamate?
The IUPAC name of carbamimidoyl N-aminocarbamate (CID 174816859) is carbamimidoyl N-aminocarbamate.
What is the SMILES notation for carbamimidoyl N-aminocarbamate?
The canonical SMILES for carbamimidoyl N-aminocarbamate is [H]/N=C(\N)OC(=O)NN.
What is the InChIKey of carbamimidoyl N-aminocarbamate?
The InChIKey is GUOBVGQXEXTHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N4O2/c3-1(4)8-2(7)6-5/h5H2,(H3,3,4)(H,6,7).
What are the key properties of carbamimidoyl N-aminocarbamate?
carbamimidoyl N-aminocarbamate has a molecular weight of 118.10 g/mol, XLogP of -1.52, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamimidoyl N-aminocarbamate is sourced from PubChem (CID 174816859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).