About amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane
amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane (PubChem CID 174830087) has the molecular formula C14H24ClN3O2
and a molecular weight of 301.82 g/mol. Its IUPAC name is amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane.
Molecular Properties
| Compound Name | amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane |
| PubChem CID | 174830087 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane |
| SMILES | CCl.NC1CCCC(N(N)C(=O)O)C1.c1ccccc1 |
| InChI | InChI=1S/C7H15N3O2.C6H6.CH3Cl/c8-5-2-1-3-6(4-5)10(9)7(11)12;1-2-4-6-5-3-1;1-2/h5-6H,1-4,8-9H2,(H,11,12);1-6H;1H3 |
| InChIKey | GPHDZMXMUKWXEG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane?
The IUPAC name of amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane (CID 174830087) is amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane.
What is the SMILES notation for amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane?
The canonical SMILES for amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane is CCl.NC1CCCC(N(N)C(=O)O)C1.c1ccccc1.
What is the InChIKey of amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane?
The InChIKey is GPHDZMXMUKWXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2.C6H6.CH3Cl/c8-5-2-1-3-6(4-5)10(9)7(11)12;1-2-4-6-5-3-1;1-2/h5-6H,1-4,8-9H2,(H,11,12);1-6H;1H3.
What are the key properties of amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane?
amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane has a molecular weight of 301.82 g/mol, XLogP of 2.65, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino-(3-aminocyclohexyl)carbamic acid;benzene;chloromethane is sourced from PubChem (CID 174830087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).