C28H27N6O3S- — CID 174830349
4-[[3-[[8-[4-[2-cyanoethyl(sulfinato)amino]phenyl]quinazolin-2-yl]amino]phenyl]methyl]morpholine (PubChem CID 174830349) has the molecular formula C28H27N6O3S- and a molecular weight of 527.63 g/mol. Its IUPAC name is 4-[[3-[[8-[4-[2-cyanoethyl(sulfinato)amino]phenyl]quinazolin-2-yl]amino]phenyl]methyl]morpholine.
| Compound Name | 4-[[3-[[8-[4-[2-cyanoethyl(sulfinato)amino]phenyl]quinazolin-2-yl]amino]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 174830349 |
| Molecular Formula | C28H27N6O3S- |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-[[3-[[8-[4-[2-cyanoethyl(sulfinato)amino]phenyl]quinazolin-2-yl]amino]phenyl]methyl]morpholine |
| SMILES | N#CCCN(c1ccc(-c2cccc3cnc(Nc4cccc(CN5CCOCC5)c4)nc23)cc1)S(=O)[O-] |
| InChI | InChI=1S/C28H28N6O3S/c29-12-3-13-34(38(35)36)25-10-8-22(9-11-25)26-7-2-5-23-19-30-28(32-27(23)26)31-24-6-1-4-21(18-24)20-33-14-16-37-17-15-33/h1-2,4-11,18-19H,3,13-17,20H2,(H,35,36)(H,30,31,32)/p-1 |
| InChIKey | APDXDJVTSOEEIW-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|