About N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide
N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide (PubChem CID 174830367) has the molecular formula C20H24IN3
and a molecular weight of 433.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide |
| PubChem CID | 174830367 |
| Molecular Formula | C20H24IN3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide |
| SMILES | Cc1cc(C=Cc2ccc(N(C)C)cc2)c[nH]1.I.c1ccncc1 |
| InChI | InChI=1S/C15H18N2.C5H5N.HI/c1-12-10-14(11-16-12)5-4-13-6-8-15(9-7-13)17(2)3;1-2-4-6-5-3-1;/h4-11,16H,1-3H3;1-5H;1H |
| InChIKey | FXSQOUWBKOCQGT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide?
The IUPAC name of N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide (CID 174830367) is N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide.
What is the SMILES notation for N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide?
The canonical SMILES for N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide is Cc1cc(C=Cc2ccc(N(C)C)cc2)c[nH]1.I.c1ccncc1.
What is the InChIKey of N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide?
The InChIKey is FXSQOUWBKOCQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.C5H5N.HI/c1-12-10-14(11-16-12)5-4-13-6-8-15(9-7-13)17(2)3;1-2-4-6-5-3-1;/h4-11,16H,1-3H3;1-5H;1H.
What are the key properties of N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide?
N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide has a molecular weight of 433.34 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[2-(5-methyl-1H-pyrrol-3-yl)ethenyl]aniline;pyridine;hydroiodide is sourced from PubChem (CID 174830367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).