C24H26ClN3O2S — CID 17483110
4-chloro-N-[3-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]phenyl]benzamide (PubChem CID 17483110) has the molecular formula C24H26ClN3O2S and a molecular weight of 456.01 g/mol. Its IUPAC name is 4-chloro-N-[3-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17483110 |
| Molecular Formula | C24H26ClN3O2S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-chloro-N-[3-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CNCC(c2cccs2)N2CCOCC2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O2S/c25-20-8-6-19(7-9-20)24(29)27-21-4-1-3-18(15-21)16-26-17-22(23-5-2-14-31-23)28-10-12-30-13-11-28/h1-9,14-15,22,26H,10-13,16-17H2,(H,27,29) |
| InChIKey | OQVPDDXPAINAHQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |