C16H11NO7 — CID 174831428
4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]pyridine-2,3-dicarboxylic acid (PubChem CID 174831428) has the molecular formula C16H11NO7 and a molecular weight of 329.26 g/mol. Its IUPAC name is 4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]pyridine-2,3-dicarboxylic acid.
| Compound Name | 4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]pyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174831428 |
| Molecular Formula | C16H11NO7 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]pyridine-2,3-dicarboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)c1ccnc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C16H11NO7/c18-10(3-1-8-2-4-11(19)12(20)7-8)9-5-6-17-14(16(23)24)13(9)15(21)22/h1-7,19-20H,(H,21,22)(H,23,24) |
| InChIKey | UJPJMSDJBQRVAO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|