C16H21ClN4 — CID 174833996
(5S)-1-benzyl-3-(3-chloro-1-methylpyrazol-4-yl)-5-methylpiperazine (PubChem CID 174833996) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is (5S)-1-benzyl-3-(3-chloro-1-methylpyrazol-4-yl)-5-methylpiperazine.
| Compound Name | (5S)-1-benzyl-3-(3-chloro-1-methylpyrazol-4-yl)-5-methylpiperazine |
|---|---|
| PubChem CID | 174833996 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (5S)-1-benzyl-3-(3-chloro-1-methylpyrazol-4-yl)-5-methylpiperazine |
| SMILES | C[C@H]1CN(Cc2ccccc2)CC(c2cn(C)nc2Cl)N1 |
| InChI | InChI=1S/C16H21ClN4/c1-12-8-21(9-13-6-4-3-5-7-13)11-15(18-12)14-10-20(2)19-16(14)17/h3-7,10,12,15,18H,8-9,11H2,1-2H3/t12-,15?/m0/s1 |
| InChIKey | PVSMJFIMWCJKIG-SFVWDYPZSA-N |
| XLogP | 2.61 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |