C16H11NOS2 — CID 174836952
4-(furan-3-yl)-3-thiophen-2-yl-2-thiophen-3-yl-1H-pyrrole (PubChem CID 174836952) has the molecular formula C16H11NOS2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(furan-3-yl)-3-thiophen-2-yl-2-thiophen-3-yl-1H-pyrrole.
| Compound Name | 4-(furan-3-yl)-3-thiophen-2-yl-2-thiophen-3-yl-1H-pyrrole |
|---|---|
| PubChem CID | 174836952 |
| Molecular Formula | C16H11NOS2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-(furan-3-yl)-3-thiophen-2-yl-2-thiophen-3-yl-1H-pyrrole |
| SMILES | c1csc(-c2c(-c3ccoc3)c[nH]c2-c2ccsc2)c1 |
| InChI | InChI=1S/C16H11NOS2/c1-2-14(20-6-1)15-13(11-3-5-18-9-11)8-17-16(15)12-4-7-19-10-12/h1-10,17H |
| InChIKey | YKVFVVZZTRPXBX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |