C21H15NO4S2 — CID 66680342
2-[[3-(furan-3-yl)benzoyl]amino]-5-methyl-4-thiophen-2-ylthiophene-3-carboxylic acid (PubChem CID 66680342) has the molecular formula C21H15NO4S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[[3-(furan-3-yl)benzoyl]amino]-5-methyl-4-thiophen-2-ylthiophene-3-carboxylic acid.
| Compound Name | 2-[[3-(furan-3-yl)benzoyl]amino]-5-methyl-4-thiophen-2-ylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 66680342 |
| Molecular Formula | C21H15NO4S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 2-[[3-(furan-3-yl)benzoyl]amino]-5-methyl-4-thiophen-2-ylthiophene-3-carboxylic acid |
| SMILES | Cc1sc(NC(=O)c2cccc(-c3ccoc3)c2)c(C(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C21H15NO4S2/c1-12-17(16-6-3-9-27-16)18(21(24)25)20(28-12)22-19(23)14-5-2-4-13(10-14)15-7-8-26-11-15/h2-11H,1H3,(H,22,23)(H,24,25) |
| InChIKey | COHJKIGNJMJIBQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|