C13H20N6O — CID 174840503
1,5-bis(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-3-one (PubChem CID 174840503) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 1,5-bis(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-3-one.
| Compound Name | 1,5-bis(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 174840503 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1,5-bis(3,5-dimethyl-1,2,4-triazol-1-yl)pentan-3-one |
| SMILES | Cc1nc(C)n(CCC(=O)CCn2nc(C)nc2C)n1 |
| InChI | InChI=1S/C13H20N6O/c1-9-14-11(3)18(16-9)7-5-13(20)6-8-19-12(4)15-10(2)17-19/h5-8H2,1-4H3 |
| InChIKey | WVIUYWFAJHYMHL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |