C20H18O2 — CID 174841737
1,3-dimethyl-1,3,4,5-tetrahydrochrysene-2,6-dione (PubChem CID 174841737) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,3-dimethyl-1,3,4,5-tetrahydrochrysene-2,6-dione.
| Compound Name | 1,3-dimethyl-1,3,4,5-tetrahydrochrysene-2,6-dione |
|---|---|
| PubChem CID | 174841737 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1,3-dimethyl-1,3,4,5-tetrahydrochrysene-2,6-dione |
| SMILES | CC1Cc2c(ccc3c2CC(=O)c2ccccc2-3)C(C)C1=O |
| InChI | InChI=1S/C20H18O2/c1-11-9-17-13(12(2)20(11)22)7-8-15-14-5-3-4-6-16(14)19(21)10-18(15)17/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | RWNKMLUJHOKWPP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |