C27H29NO2 — CID 174843666
1-benzhydrylindole-2,3-dione;hexane (PubChem CID 174843666) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-benzhydrylindole-2,3-dione;hexane.
| Compound Name | 1-benzhydrylindole-2,3-dione;hexane |
|---|---|
| PubChem CID | 174843666 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 1-benzhydrylindole-2,3-dione;hexane |
| SMILES | CCCCCC.O=C1C(=O)N(C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H15NO2.C6H14/c23-20-17-13-7-8-14-18(17)22(21(20)24)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16;1-3-5-6-4-2/h1-14,19H;3-6H2,1-2H3 |
| InChIKey | IMLNABVWFFYARP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|