C11H14N2O — CID 174845961
2-[(4-methoxyphenyl)methyl]-1,5-dihydropyrazole (PubChem CID 174845961) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-1,5-dihydropyrazole.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 174845961 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-1,5-dihydropyrazole |
| SMILES | COc1ccc(CN2C=CCN2)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-14-11-5-3-10(4-6-11)9-13-8-2-7-12-13/h2-6,8,12H,7,9H2,1H3 |
| InChIKey | VHIMEZWLPBCZNO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |