C5H7N3O2SZn — CID 174846708
6-aminosulfanyl-1-methylpyrimidine-2,4-dione;zinc (PubChem CID 174846708) has the molecular formula C5H7N3O2SZn and a molecular weight of 238.59 g/mol. Its IUPAC name is 6-aminosulfanyl-1-methylpyrimidine-2,4-dione;zinc.
| Compound Name | 6-aminosulfanyl-1-methylpyrimidine-2,4-dione;zinc |
|---|---|
| PubChem CID | 174846708 |
| Molecular Formula | C5H7N3O2SZn |
| Molecular Weight | 238.59 g/mol |
| Exact Mass | 236.96 |
| IUPAC Name | 6-aminosulfanyl-1-methylpyrimidine-2,4-dione;zinc |
| SMILES | Cn1c(SN)cc(=O)[nH]c1=O.[Zn] |
| InChI | InChI=1S/C5H7N3O2S.Zn/c1-8-4(11-6)2-3(9)7-5(8)10;/h2H,6H2,1H3,(H,7,9,10); |
| InChIKey | URYRLBYSXXUERD-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.59 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|