C5H5N2NaO3 — CID 23704376
sodium 3-methyl-2,4-dioxo-1H-pyrimidin-6-olate (PubChem CID 23704376) has the molecular formula C5H5N2NaO3 and a molecular weight of 164.10 g/mol. Its IUPAC name is sodium 3-methyl-2,4-dioxo-1H-pyrimidin-6-olate.
| Compound Name | sodium 3-methyl-2,4-dioxo-1H-pyrimidin-6-olate |
|---|---|
| PubChem CID | 23704376 |
| Molecular Formula | C5H5N2NaO3 |
| Molecular Weight | 164.10 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | sodium 3-methyl-2,4-dioxo-1H-pyrimidin-6-olate |
| SMILES | Cn1c(=O)cc([O-])[nH]c1=O.[Na+] |
| InChI | InChI=1S/C5H6N2O3.Na/c1-7-4(9)2-3(8)6-5(7)10;/h2,8H,1H3,(H,6,10);/q;+1/p-1 |
| InChIKey | MSZNBVFNDMWTDR-UHFFFAOYSA-M |
| XLogP | -4.85 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.10 |
| LogP ≤ 5 | -4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |