About butylaminosulfanylurea
butylaminosulfanylurea (PubChem CID 174849545) has the molecular formula C5H13N3OS
and a molecular weight of 163.25 g/mol. Its IUPAC name is butylaminosulfanylurea.
Molecular Properties
| Compound Name | butylaminosulfanylurea |
| PubChem CID | 174849545 |
| Molecular Formula | C5H13N3OS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | butylaminosulfanylurea |
| SMILES | CCCCNSNC(N)=O |
| InChI | InChI=1S/C5H13N3OS/c1-2-3-4-7-10-8-5(6)9/h7H,2-4H2,1H3,(H3,6,8,9) |
| InChIKey | CHOBTDBRJBUDOL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butylaminosulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylaminosulfanylurea?
The IUPAC name of butylaminosulfanylurea (CID 174849545) is butylaminosulfanylurea.
What is the SMILES notation for butylaminosulfanylurea?
The canonical SMILES for butylaminosulfanylurea is CCCCNSNC(N)=O.
What is the InChIKey of butylaminosulfanylurea?
The InChIKey is CHOBTDBRJBUDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3OS/c1-2-3-4-7-10-8-5(6)9/h7H,2-4H2,1H3,(H3,6,8,9).
What are the key properties of butylaminosulfanylurea?
butylaminosulfanylurea has a molecular weight of 163.25 g/mol, XLogP of 0.61, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylaminosulfanylurea is sourced from PubChem (CID 174849545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).