C9H14F2N2O — CID 174849959
4-(2,2-difluoroethoxy)-1,3-diethylpyrazole (PubChem CID 174849959) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1,3-diethylpyrazole.
| Compound Name | 4-(2,2-difluoroethoxy)-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 174849959 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)cc1OCC(F)F |
| InChI | InChI=1S/C9H14F2N2O/c1-3-7-8(14-6-9(10)11)5-13(4-2)12-7/h5,9H,3-4,6H2,1-2H3 |
| InChIKey | LZKDKZCONLPIJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |