About diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine
diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine (PubChem CID 174851275) has the molecular formula C12H29NO4Si
and a molecular weight of 279.45 g/mol. Its IUPAC name is diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine.
Molecular Properties
| Compound Name | diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine |
| PubChem CID | 174851275 |
| Molecular Formula | C12H29NO4Si |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine |
| SMILES | CCCN.CCOC(OCC)[Si](C)(O)CC1CO1 |
| InChI | InChI=1S/C9H20O4Si.C3H9N/c1-4-11-9(12-5-2)14(3,10)7-8-6-13-8;1-2-3-4/h8-10H,4-7H2,1-3H3;2-4H2,1H3 |
| InChIKey | JGKADTXCFGHNTL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine?
The IUPAC name of diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine (CID 174851275) is diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine.
What is the SMILES notation for diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine?
The canonical SMILES for diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine is CCCN.CCOC(OCC)[Si](C)(O)CC1CO1.
What is the InChIKey of diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine?
The InChIKey is JGKADTXCFGHNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4Si.C3H9N/c1-4-11-9(12-5-2)14(3,10)7-8-6-13-8;1-2-3-4/h8-10H,4-7H2,1-3H3;2-4H2,1H3.
What are the key properties of diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine?
diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine has a molecular weight of 279.45 g/mol, XLogP of 1.25, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxymethyl-hydroxy-methyl-(oxiran-2-ylmethyl)silane;propan-1-amine is sourced from PubChem (CID 174851275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).