About 1,2-dihydrobenzimidazol-2-ide;gold(1+)
1,2-dihydrobenzimidazol-2-ide;gold(1+) (PubChem CID 174852553) has the molecular formula C7H5AuN2
and a molecular weight of 314.10 g/mol. Its IUPAC name is 1,2-dihydrobenzimidazol-2-ide;gold(1+).
Molecular Properties
| Compound Name | 1,2-dihydrobenzimidazol-2-ide;gold(1+) |
| PubChem CID | 174852553 |
| Molecular Formula | C7H5AuN2 |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1,2-dihydrobenzimidazol-2-ide;gold(1+) |
| SMILES | [Au+].[c-]1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5N2.Au/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1 |
| InChIKey | UIPPAXNFISBHMA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydrobenzimidazol-2-ide;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrobenzimidazol-2-ide;gold(1+)?
The IUPAC name of 1,2-dihydrobenzimidazol-2-ide;gold(1+) (CID 174852553) is 1,2-dihydrobenzimidazol-2-ide;gold(1+).
What is the SMILES notation for 1,2-dihydrobenzimidazol-2-ide;gold(1+)?
The canonical SMILES for 1,2-dihydrobenzimidazol-2-ide;gold(1+) is [Au+].[c-]1nc2ccccc2[nH]1.
What is the InChIKey of 1,2-dihydrobenzimidazol-2-ide;gold(1+)?
The InChIKey is UIPPAXNFISBHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Au/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1.
What are the key properties of 1,2-dihydrobenzimidazol-2-ide;gold(1+)?
1,2-dihydrobenzimidazol-2-ide;gold(1+) has a molecular weight of 314.10 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrobenzimidazol-2-ide;gold(1+) is sourced from PubChem (CID 174852553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).