About (2-aminophenyl)cyanamide
(2-aminophenyl)cyanamide (PubChem CID 23459373) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (2-aminophenyl)cyanamide.
Molecular Properties
| Compound Name | (2-aminophenyl)cyanamide |
| PubChem CID | 23459373 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (2-aminophenyl)cyanamide |
| SMILES | N#CNc1ccccc1N |
| InChI | InChI=1S/C7H7N3/c8-5-10-7-4-2-1-3-6(7)9/h1-4,10H,9H2 |
| InChIKey | FGGPJHXGBZNABQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)cyanamide?
The IUPAC name of (2-aminophenyl)cyanamide (CID 23459373) is (2-aminophenyl)cyanamide.
What is the SMILES notation for (2-aminophenyl)cyanamide?
The canonical SMILES for (2-aminophenyl)cyanamide is N#CNc1ccccc1N.
What is the InChIKey of (2-aminophenyl)cyanamide?
The InChIKey is FGGPJHXGBZNABQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-5-10-7-4-2-1-3-6(7)9/h1-4,10H,9H2.
What are the key properties of (2-aminophenyl)cyanamide?
(2-aminophenyl)cyanamide has a molecular weight of 133.15 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)cyanamide is sourced from PubChem (CID 23459373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).