C19H27N2O+ — CID 174853218
N-(2,6-dimethylphenyl)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octane-2-carboxamide (PubChem CID 174853218) has the molecular formula C19H27N2O+ and a molecular weight of 299.44 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octane-2-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octane-2-carboxamide |
|---|---|
| PubChem CID | 174853218 |
| Molecular Formula | C19H27N2O+ |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octane-2-carboxamide |
| SMILES | C=CC[N+]12CCC(CC1)CC2C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C19H26N2O/c1-4-10-21-11-8-16(9-12-21)13-17(21)19(22)20-18-14(2)6-5-7-15(18)3/h4-7,16-17H,1,8-13H2,2-3H3/p+1 |
| InChIKey | OHCJRDFNRWSWLQ-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|