C22H35N2O3+ — CID 156733770
[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]methyl butanoate (PubChem CID 156733770) has the molecular formula C22H35N2O3+ and a molecular weight of 375.53 g/mol. Its IUPAC name is [(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]methyl butanoate.
| Compound Name | [(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]methyl butanoate |
|---|---|
| PubChem CID | 156733770 |
| Molecular Formula | C22H35N2O3+ |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | [(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[N+]1(CCC)CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C22H34N2O3/c1-5-10-20(25)27-16-24(14-6-2)15-8-7-13-19(24)22(26)23-21-17(3)11-9-12-18(21)4/h9,11-12,19H,5-8,10,13-16H2,1-4H3/p+1/t19-,24?/m0/s1 |
| InChIKey | WMZLIJWLMCHLRG-XGLRFROISA-O |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|