C33H45N2O4+ — CID 142391588
[4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]-2-methyl-6-pent-4-ynoxyphenyl] acetate (PubChem CID 142391588) has the molecular formula C33H45N2O4+ and a molecular weight of 533.73 g/mol. Its IUPAC name is [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]-2-methyl-6-pent-4-ynoxyphenyl] acetate.
| Compound Name | [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]-2-methyl-6-pent-4-ynoxyphenyl] acetate |
|---|---|
| PubChem CID | 142391588 |
| Molecular Formula | C33H45N2O4+ |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]-2-methyl-6-pent-4-ynoxyphenyl] acetate |
| SMILES | C#CCCCOc1cc(C[N+]2(CCCC)CCCCC2C(=O)Nc2c(C)cccc2C)cc(C)c1OC(C)=O |
| InChI | InChI=1S/C33H44N2O4/c1-7-9-13-20-38-30-22-28(21-26(5)32(30)39-27(6)36)23-35(18-10-8-2)19-12-11-17-29(35)33(37)34-31-24(3)15-14-16-25(31)4/h1,14-16,21-22,29H,8-13,17-20,23H2,2-6H3/p+1 |
| InChIKey | BPBVJEJDUKUFNZ-UHFFFAOYSA-O |
| XLogP | 6.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|