C38H58N3O6+ — CID 161119451
2-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]ethyl [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] carbonate (PubChem CID 161119451) has the molecular formula C38H58N3O6+ and a molecular weight of 652.90 g/mol. Its IUPAC name is 2-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]ethyl [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] carbonate.
| Compound Name | 2-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]ethyl [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] carbonate |
|---|---|
| PubChem CID | 161119451 |
| Molecular Formula | C38H58N3O6+ |
| Molecular Weight | 652.90 g/mol |
| Exact Mass | 652.43 |
| IUPAC Name | 2-[(2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-propylpiperidin-1-ium-1-yl]ethyl [2-methoxy-4-[(8-methylnonanoylamino)methyl]phenyl] carbonate |
| SMILES | CCC[N+]1(CCOC(=O)Oc2ccc(CNC(=O)CCCCCCC(C)C)cc2OC)CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C38H57N3O6/c1-7-22-41(23-13-12-18-32(41)37(43)40-36-29(4)16-14-17-30(36)5)24-25-46-38(44)47-33-21-20-31(26-34(33)45-6)27-39-35(42)19-11-9-8-10-15-28(2)3/h14,16-17,20-21,26,28,32H,7-13,15,18-19,22-25,27H2,1-6H3,(H-,39,40,42,43)/p+1/t32-,41?/m0/s1 |
| InChIKey | UKTJMGHYKRZFLT-IROIYFLTSA-O |
| XLogP | 7.86 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.90 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|