C30H41N2O3+ — CID 142391564
[4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]phenyl] pent-4-enoate (PubChem CID 142391564) has the molecular formula C30H41N2O3+ and a molecular weight of 477.67 g/mol. Its IUPAC name is [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]phenyl] pent-4-enoate.
| Compound Name | [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]phenyl] pent-4-enoate |
|---|---|
| PubChem CID | 142391564 |
| Molecular Formula | C30H41N2O3+ |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | [4-[[1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidin-1-ium-1-yl]methyl]phenyl] pent-4-enoate |
| SMILES | C=CCCC(=O)Oc1ccc(C[N+]2(CCCC)CCCCC2C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C30H40N2O3/c1-5-7-15-28(33)35-26-18-16-25(17-19-26)22-32(20-8-6-2)21-10-9-14-27(32)30(34)31-29-23(3)12-11-13-24(29)4/h5,11-13,16-19,27H,1,6-10,14-15,20-22H2,2-4H3/p+1 |
| InChIKey | WXVYYPNNOUKBNP-UHFFFAOYSA-O |
| XLogP | 6.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|