C18H27N2O3+ — CID 171053660
methyl 2-[(1S,2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-methylpiperidin-1-ium-1-yl]acetate (PubChem CID 171053660) has the molecular formula C18H27N2O3+ and a molecular weight of 319.42 g/mol. Its IUPAC name is methyl 2-[(1S,2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-methylpiperidin-1-ium-1-yl]acetate.
| Compound Name | methyl 2-[(1S,2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-methylpiperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 171053660 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | methyl 2-[(1S,2S)-2-[(2,6-dimethylphenyl)carbamoyl]-1-methylpiperidin-1-ium-1-yl]acetate |
| SMILES | COC(=O)C[N@+]1(C)CCCC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H26N2O3/c1-13-8-7-9-14(2)17(13)19-18(22)15-10-5-6-11-20(15,3)12-16(21)23-4/h7-9,15H,5-6,10-12H2,1-4H3/p+1/t15-,20-/m0/s1 |
| InChIKey | XIQAYJSDMSEJNZ-YWZLYKJASA-O |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|